About (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine
(2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine (PubChem CID 158852291) has the molecular formula C7H14FN
and a molecular weight of 131.19 g/mol. Its IUPAC name is (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine |
| PubChem CID | 158852291 |
| Molecular Formula | C7H14FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine |
| SMILES | CN(C)C1CCC[C@@H]1F |
| InChI | InChI=1S/C7H14FN/c1-9(2)7-5-3-4-6(7)8/h6-7H,3-5H2,1-2H3/t6-,7?/m0/s1 |
| InChIKey | IZPMOUFNOLRZNL-PKPIPKONSA-N |
| XLogP | 1.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine?
The IUPAC name of (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine (CID 158852291) is (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine.
What is the SMILES notation for (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine?
The canonical SMILES for (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine is CN(C)C1CCC[C@@H]1F.
What is the InChIKey of (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine?
The InChIKey is IZPMOUFNOLRZNL-PKPIPKONSA-N. The full InChI is InChI=1S/C7H14FN/c1-9(2)7-5-3-4-6(7)8/h6-7H,3-5H2,1-2H3/t6-,7?/m0/s1.
What are the key properties of (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine?
(2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine has a molecular weight of 131.19 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine is sourced from PubChem (CID 158852291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).