C7H14FN — CID 158852291
(2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine (PubChem CID 158852291) has the molecular formula C7H14FN and a molecular weight of 131.19 g/mol. Its IUPAC name is (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine.
| Compound Name | (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 158852291 |
| Molecular Formula | C7H14FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | (2S)-2-fluoro-N,N-dimethylcyclopentan-1-amine |
| SMILES | CN(C)C1CCC[C@@H]1F |
| InChI | InChI=1S/C7H14FN/c1-9(2)7-5-3-4-6(7)8/h6-7H,3-5H2,1-2H3/t6-,7?/m0/s1 |
| InChIKey | IZPMOUFNOLRZNL-PKPIPKONSA-N |
| XLogP | 1.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |