About cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine
cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine (PubChem CID 55281587) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine.
Analyze cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine?
The IUPAC name of cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine (CID 55281587) is cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine.
What is the SMILES notation for cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine?
The canonical SMILES for cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine is CN(C)[C@H]1CCC[C@H]1N.
What is the InChIKey of cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine?
The InChIKey is VCJNAZAMCYBDCP-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H16N2/c1-9(2)7-5-3-4-6(7)8/h6-7H,3-5,8H2,1-2H3/t6-,7+/m1/s1.
What are the key properties of cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine?
cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine has a molecular weight of 128.22 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-1-N,1-N-dimethylcyclopentane-1,2-diamine is sourced from PubChem (CID 55281587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).