C11H22N2O — CID 43611076
1-N-methyl-1-N-(oxan-4-yl)cyclopentane-1,2-diamine (PubChem CID 43611076) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-N-methyl-1-N-(oxan-4-yl)cyclopentane-1,2-diamine.
| Compound Name | 1-N-methyl-1-N-(oxan-4-yl)cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 43611076 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-N-methyl-1-N-(oxan-4-yl)cyclopentane-1,2-diamine |
| SMILES | CN(C1CCOCC1)C1CCCC1N |
| InChI | InChI=1S/C11H22N2O/c1-13(9-5-7-14-8-6-9)11-4-2-3-10(11)12/h9-11H,2-8,12H2,1H3 |
| InChIKey | SLJMJUPLHSOVRD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |