C9H17FN2 — CID 131995467
(7Z)-2-fluoro-N,N-dimethyl-1,2,3,4,5,6-hexahydroazocin-3-amine (PubChem CID 131995467) has the molecular formula C9H17FN2 and a molecular weight of 172.25 g/mol. Its IUPAC name is (7Z)-2-fluoro-N,N-dimethyl-1,2,3,4,5,6-hexahydroazocin-3-amine.
| Compound Name | (7Z)-2-fluoro-N,N-dimethyl-1,2,3,4,5,6-hexahydroazocin-3-amine |
|---|---|
| PubChem CID | 131995467 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | (7Z)-2-fluoro-N,N-dimethyl-1,2,3,4,5,6-hexahydroazocin-3-amine |
| SMILES | CN(C)C1CCC/C=C\NC1F |
| InChI | InChI=1S/C9H17FN2/c1-12(2)8-6-4-3-5-7-11-9(8)10/h5,7-9,11H,3-4,6H2,1-2H3/b7-5- |
| InChIKey | DGWZIVVWXZVULZ-ALCCZGGFSA-N |
| XLogP | 1.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|