C18H46N2O2 — CID 166075862
1-(dimethylamino)butan-2-ol;ethane;1-methylpiperidin-4-ol (PubChem CID 166075862) has the molecular formula C18H46N2O2 and a molecular weight of 322.58 g/mol. Its IUPAC name is 1-(dimethylamino)butan-2-ol;ethane;1-methylpiperidin-4-ol.
| Compound Name | 1-(dimethylamino)butan-2-ol;ethane;1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 166075862 |
| Molecular Formula | C18H46N2O2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.36 |
| IUPAC Name | 1-(dimethylamino)butan-2-ol;ethane;1-methylpiperidin-4-ol |
| SMILES | CC.CC.CC.CCC(O)CN(C)C.CN1CCC(O)CC1 |
| InChI | InChI=1S/C6H13NO.C6H15NO.3C2H6/c1-7-4-2-6(8)3-5-7;1-4-6(8)5-7(2)3;3*1-2/h6,8H,2-5H2,1H3;6,8H,4-5H2,1-3H3;3*1-2H3 |
| InChIKey | KOOWAQYAXJLKLB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |