C7H17NOP+ — CID 173453320
1,2-dimethylpyrrolidine;methyl(oxo)phosphanium (PubChem CID 173453320) has the molecular formula C7H17NOP+ and a molecular weight of 162.19 g/mol. Its IUPAC name is 1,2-dimethylpyrrolidine;methyl(oxo)phosphanium.
| Compound Name | 1,2-dimethylpyrrolidine;methyl(oxo)phosphanium |
|---|---|
| PubChem CID | 173453320 |
| Molecular Formula | C7H17NOP+ |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1,2-dimethylpyrrolidine;methyl(oxo)phosphanium |
| SMILES | CC1CCCN1C.C[PH+]=O |
| InChI | InChI=1S/C6H13N.CH3OP/c1-6-4-3-5-7(6)2;1-3-2/h6H,3-5H2,1-2H3;1H3/p+1 |
| InChIKey | WBJYDPUXUMFMCQ-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|