C12H25N — CID 177123867
(4S)-1-tert-butyl-2,2,4-trimethylpiperidine (PubChem CID 177123867) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is (4S)-1-tert-butyl-2,2,4-trimethylpiperidine.
| Compound Name | (4S)-1-tert-butyl-2,2,4-trimethylpiperidine |
|---|---|
| PubChem CID | 177123867 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (4S)-1-tert-butyl-2,2,4-trimethylpiperidine |
| SMILES | C[C@H]1CCN(C(C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C12H25N/c1-10-7-8-13(11(2,3)4)12(5,6)9-10/h10H,7-9H2,1-6H3/t10-/m0/s1 |
| InChIKey | OUQZIOIOWORKEY-JTQLQIEISA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |