C17H36N2 — CID 138627615
1,4-ditert-butyl-5,5,7-trimethyl-1,4-diazocane (PubChem CID 138627615) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 1,4-ditert-butyl-5,5,7-trimethyl-1,4-diazocane.
| Compound Name | 1,4-ditert-butyl-5,5,7-trimethyl-1,4-diazocane |
|---|---|
| PubChem CID | 138627615 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 1,4-ditert-butyl-5,5,7-trimethyl-1,4-diazocane |
| SMILES | CC1CN(C(C)(C)C)CCN(C(C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C17H36N2/c1-14-12-17(8,9)19(16(5,6)7)11-10-18(13-14)15(2,3)4/h14H,10-13H2,1-9H3 |
| InChIKey | TYWKRWDMUIRWAI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |