C13H25FN2 — CID 158207232
1-tert-butyl-4-(3-fluoro-3-methylcyclobutyl)piperazine (PubChem CID 158207232) has the molecular formula C13H25FN2 and a molecular weight of 228.35 g/mol. Its IUPAC name is 1-tert-butyl-4-(3-fluoro-3-methylcyclobutyl)piperazine.
| Compound Name | 1-tert-butyl-4-(3-fluoro-3-methylcyclobutyl)piperazine |
|---|---|
| PubChem CID | 158207232 |
| Molecular Formula | C13H25FN2 |
| Molecular Weight | 228.35 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1-tert-butyl-4-(3-fluoro-3-methylcyclobutyl)piperazine |
| SMILES | CC1(F)CC(N2CCN(C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C13H25FN2/c1-12(2,3)16-7-5-15(6-8-16)11-9-13(4,14)10-11/h11H,5-10H2,1-4H3 |
| InChIKey | YFUAUVFVVMRMJU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |