C27H54N2 — CID 159702523
1,4-ditert-butylpiperazine;2,6-ditert-butylspiro[3.3]heptane (PubChem CID 159702523) has the molecular formula C27H54N2 and a molecular weight of 406.74 g/mol. Its IUPAC name is 1,4-ditert-butylpiperazine;2,6-ditert-butylspiro[3.3]heptane.
| Compound Name | 1,4-ditert-butylpiperazine;2,6-ditert-butylspiro[3.3]heptane |
|---|---|
| PubChem CID | 159702523 |
| Molecular Formula | C27H54N2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.43 |
| IUPAC Name | 1,4-ditert-butylpiperazine;2,6-ditert-butylspiro[3.3]heptane |
| SMILES | CC(C)(C)C1CC2(C1)CC(C(C)(C)C)C2.CC(C)(C)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28.C12H26N2/c1-13(2,3)11-7-15(8-11)9-12(10-15)14(4,5)6;1-11(2,3)13-7-9-14(10-8-13)12(4,5)6/h11-12H,7-10H2,1-6H3;7-10H2,1-6H3 |
| InChIKey | MXUMTNHXDIMJQB-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |