C19H38N4 — CID 172511600
1-tert-butyl-4-[1-[(1-tert-butylazetidin-3-yl)methyl]azetidin-3-yl]piperazine (PubChem CID 172511600) has the molecular formula C19H38N4 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1-tert-butyl-4-[1-[(1-tert-butylazetidin-3-yl)methyl]azetidin-3-yl]piperazine.
| Compound Name | 1-tert-butyl-4-[1-[(1-tert-butylazetidin-3-yl)methyl]azetidin-3-yl]piperazine |
|---|---|
| PubChem CID | 172511600 |
| Molecular Formula | C19H38N4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.31 |
| IUPAC Name | 1-tert-butyl-4-[1-[(1-tert-butylazetidin-3-yl)methyl]azetidin-3-yl]piperazine |
| SMILES | CC(C)(C)N1CCN(C2CN(CC3CN(C(C)(C)C)C3)C2)CC1 |
| InChI | InChI=1S/C19H38N4/c1-18(2,3)22-9-7-21(8-10-22)17-14-20(15-17)11-16-12-23(13-16)19(4,5)6/h16-17H,7-15H2,1-6H3 |
| InChIKey | GRSAKRQEGACWPE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |