C18H37N3 — CID 156550929
1-tert-butyl-4-[[(3R)-1-tert-butylpiperidin-3-yl]methyl]piperazine (PubChem CID 156550929) has the molecular formula C18H37N3 and a molecular weight of 295.51 g/mol. Its IUPAC name is 1-tert-butyl-4-[[(3R)-1-tert-butylpiperidin-3-yl]methyl]piperazine.
| Compound Name | 1-tert-butyl-4-[[(3R)-1-tert-butylpiperidin-3-yl]methyl]piperazine |
|---|---|
| PubChem CID | 156550929 |
| Molecular Formula | C18H37N3 |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.30 |
| IUPAC Name | 1-tert-butyl-4-[[(3R)-1-tert-butylpiperidin-3-yl]methyl]piperazine |
| SMILES | CC(C)(C)N1CCN(C[C@H]2CCCN(C(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C18H37N3/c1-17(2,3)20-12-10-19(11-13-20)14-16-8-7-9-21(15-16)18(4,5)6/h16H,7-15H2,1-6H3/t16-/m1/s1 |
| InChIKey | YSRRKWNNCHTSSZ-MRXNPFEDSA-N |
| XLogP | 2.91 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |