C22H44N4 — CID 168727139
1-tert-butyl-4-[1-[[(3R)-1-tert-butylpyrrolidin-3-yl]methyl]piperidin-4-yl]piperazine (PubChem CID 168727139) has the molecular formula C22H44N4 and a molecular weight of 364.62 g/mol. Its IUPAC name is 1-tert-butyl-4-[1-[[(3R)-1-tert-butylpyrrolidin-3-yl]methyl]piperidin-4-yl]piperazine.
| Compound Name | 1-tert-butyl-4-[1-[[(3R)-1-tert-butylpyrrolidin-3-yl]methyl]piperidin-4-yl]piperazine |
|---|---|
| PubChem CID | 168727139 |
| Molecular Formula | C22H44N4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.36 |
| IUPAC Name | 1-tert-butyl-4-[1-[[(3R)-1-tert-butylpyrrolidin-3-yl]methyl]piperidin-4-yl]piperazine |
| SMILES | CC(C)(C)N1CCN(C2CCN(C[C@H]3CCN(C(C)(C)C)C3)CC2)CC1 |
| InChI | InChI=1S/C22H44N4/c1-21(2,3)25-15-13-24(14-16-25)20-8-10-23(11-9-20)17-19-7-12-26(18-19)22(4,5)6/h19-20H,7-18H2,1-6H3/t19-/m1/s1 |
| InChIKey | YDYSKSPTROZYOM-LJQANCHMSA-N |
| XLogP | 2.99 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |