C23H46N4 — CID 176841742
1-tert-butyl-4-[[1-(1-tert-butylpiperidin-4-yl)piperidin-4-yl]methyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazine (PubChem CID 176841742) has the molecular formula C23H46N4 and a molecular weight of 386.70 g/mol. Its IUPAC name is 1-tert-butyl-4-[[1-(1-tert-butylpiperidin-4-yl)piperidin-4-yl]methyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazine.
| Compound Name | 1-tert-butyl-4-[[1-(1-tert-butylpiperidin-4-yl)piperidin-4-yl]methyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazine |
|---|---|
| PubChem CID | 176841742 |
| Molecular Formula | C23H46N4 |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 386.42 |
| IUPAC Name | 1-tert-butyl-4-[[1-(1-tert-butylpiperidin-4-yl)piperidin-4-yl]methyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazine |
| SMILES | [2H]C1([2H])N(CC2CCN(C3CCN(C(C)(C)C)CC3)CC2)C([2H])([2H])C([2H])([2H])N(C(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C23H46N4/c1-22(2,3)26-13-9-21(10-14-26)25-11-7-20(8-12-25)19-24-15-17-27(18-16-24)23(4,5)6/h20-21H,7-19H2,1-6H3/i15D2,16D2,17D2,18D2 |
| InChIKey | BNMVZBSRRDYOTK-BVUACPEDSA-N |
| XLogP | 3.38 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |