C22H46N2 — CID 161492133
1-tert-butyl-2,2-dimethylpiperidine (PubChem CID 161492133) has the molecular formula C22H46N2 and a molecular weight of 338.62 g/mol. Its IUPAC name is 1-tert-butyl-2,2-dimethylpiperidine.
| Compound Name | 1-tert-butyl-2,2-dimethylpiperidine |
|---|---|
| PubChem CID | 161492133 |
| Molecular Formula | C22H46N2 |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 338.37 |
| IUPAC Name | 1-tert-butyl-2,2-dimethylpiperidine |
| SMILES | CC(C)(C)N1CCCCC1(C)C.CC(C)(C)N1CCCCC1(C)C |
| InChI | InChI=1S/2C11H23N/c2*1-10(2,3)12-9-7-6-8-11(12,4)5/h2*6-9H2,1-5H3 |
| InChIKey | WFTCBLZJFLEQFE-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |