About 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine
2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine (PubChem CID 168821111) has the molecular formula C14H30N2O
and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine |
| PubChem CID | 168821111 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOC1CN(C(C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C14H30N2O/c1-13(2,3)16-11-12(10-14(16,4)5)17-9-8-15(6)7/h12H,8-11H2,1-7H3 |
| InChIKey | BTQMMFWCEQUFEU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine?
The IUPAC name of 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine (CID 168821111) is 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine.
What is the SMILES notation for 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine?
The canonical SMILES for 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine is CN(C)CCOC1CN(C(C)(C)C)C(C)(C)C1.
What is the InChIKey of 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine?
The InChIKey is BTQMMFWCEQUFEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O/c1-13(2,3)16-11-12(10-14(16,4)5)17-9-8-15(6)7/h12H,8-11H2,1-7H3.
What are the key properties of 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine?
2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine has a molecular weight of 242.41 g/mol, XLogP of 2.22, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)oxy-N,N-dimethylethanamine is sourced from PubChem (CID 168821111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).