C16H24FN — CID 159338302
(2R,4S)-1-tert-butyl-2-(4-fluorophenyl)-4-methylpiperidine (PubChem CID 159338302) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is (2R,4S)-1-tert-butyl-2-(4-fluorophenyl)-4-methylpiperidine.
| Compound Name | (2R,4S)-1-tert-butyl-2-(4-fluorophenyl)-4-methylpiperidine |
|---|---|
| PubChem CID | 159338302 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | (2R,4S)-1-tert-butyl-2-(4-fluorophenyl)-4-methylpiperidine |
| SMILES | C[C@H]1CCN(C(C)(C)C)[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H24FN/c1-12-9-10-18(16(2,3)4)15(11-12)13-5-7-14(17)8-6-13/h5-8,12,15H,9-11H2,1-4H3/t12-,15+/m0/s1 |
| InChIKey | MNDBCHQQYDHYJL-SWLSCSKDSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |