C16H23ClFNO2 — CID 67463353
1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride (PubChem CID 67463353) has the molecular formula C16H23ClFNO2 and a molecular weight of 315.82 g/mol. Its IUPAC name is 1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67463353 |
| Molecular Formula | C16H23ClFNO2 |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride |
| SMILES | CC(C)(C)N1CCC(C(=O)O)C(c2ccc(F)cc2)C1.Cl |
| InChI | InChI=1S/C16H22FNO2.ClH/c1-16(2,3)18-9-8-13(15(19)20)14(10-18)11-4-6-12(17)7-5-11;/h4-7,13-14H,8-10H2,1-3H3,(H,19,20);1H |
| InChIKey | DBFJHSCCHCIUMY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |