C11H20ClNO — CID 130848384
1-(4-chloro-2-methylpyrrolidin-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 130848384) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is 1-(4-chloro-2-methylpyrrolidin-1-yl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(4-chloro-2-methylpyrrolidin-1-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 130848384 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1-(4-chloro-2-methylpyrrolidin-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC1CC(Cl)CN1C(=O)CC(C)(C)C |
| InChI | InChI=1S/C11H20ClNO/c1-8-5-9(12)7-13(8)10(14)6-11(2,3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | KMOCDSPRURNCLW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|