About 1-tert-butyl-2,3,5-trimethylpiperidine
1-tert-butyl-2,3,5-trimethylpiperidine (PubChem CID 175525228) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is 1-tert-butyl-2,3,5-trimethylpiperidine.
Molecular Properties
| Compound Name | 1-tert-butyl-2,3,5-trimethylpiperidine |
| PubChem CID | 175525228 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 1-tert-butyl-2,3,5-trimethylpiperidine |
| SMILES | CC1CC(C)C(C)N(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H25N/c1-9-7-10(2)11(3)13(8-9)12(4,5)6/h9-11H,7-8H2,1-6H3 |
| InChIKey | RZQLVNVHWLJRFB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-2,3,5-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2,3,5-trimethylpiperidine?
The IUPAC name of 1-tert-butyl-2,3,5-trimethylpiperidine (CID 175525228) is 1-tert-butyl-2,3,5-trimethylpiperidine.
What is the SMILES notation for 1-tert-butyl-2,3,5-trimethylpiperidine?
The canonical SMILES for 1-tert-butyl-2,3,5-trimethylpiperidine is CC1CC(C)C(C)N(C(C)(C)C)C1.
What is the InChIKey of 1-tert-butyl-2,3,5-trimethylpiperidine?
The InChIKey is RZQLVNVHWLJRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N/c1-9-7-10(2)11(3)13(8-9)12(4,5)6/h9-11H,7-8H2,1-6H3.
What are the key properties of 1-tert-butyl-2,3,5-trimethylpiperidine?
1-tert-butyl-2,3,5-trimethylpiperidine has a molecular weight of 183.34 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2,3,5-trimethylpiperidine is sourced from PubChem (CID 175525228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).