C12H25N — CID 175525228
1-tert-butyl-2,3,5-trimethylpiperidine (PubChem CID 175525228) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is 1-tert-butyl-2,3,5-trimethylpiperidine.
| Compound Name | 1-tert-butyl-2,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 175525228 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 1-tert-butyl-2,3,5-trimethylpiperidine |
| SMILES | CC1CC(C)C(C)N(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H25N/c1-9-7-10(2)11(3)13(8-9)12(4,5)6/h9-11H,7-8H2,1-6H3 |
| InChIKey | RZQLVNVHWLJRFB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |