C10H21NS — CID 114597780
2-(2,3,5-trimethylpiperidin-1-yl)ethanethiol (PubChem CID 114597780) has the molecular formula C10H21NS and a molecular weight of 187.35 g/mol. Its IUPAC name is 2-(2,3,5-trimethylpiperidin-1-yl)ethanethiol.
| Compound Name | 2-(2,3,5-trimethylpiperidin-1-yl)ethanethiol |
|---|---|
| PubChem CID | 114597780 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-(2,3,5-trimethylpiperidin-1-yl)ethanethiol |
| SMILES | CC1CC(C)C(C)N(CCS)C1 |
| InChI | InChI=1S/C10H21NS/c1-8-6-9(2)10(3)11(7-8)4-5-12/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | WHBKEZYURBDBBC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|