C12H24N2 — CID 114593869
1-(azetidin-3-ylmethyl)-2,3,5-trimethylpiperidine (PubChem CID 114593869) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-(azetidin-3-ylmethyl)-2,3,5-trimethylpiperidine.
| Compound Name | 1-(azetidin-3-ylmethyl)-2,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 114593869 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-(azetidin-3-ylmethyl)-2,3,5-trimethylpiperidine |
| SMILES | CC1CC(C)C(C)N(CC2CNC2)C1 |
| InChI | InChI=1S/C12H24N2/c1-9-4-10(2)11(3)14(7-9)8-12-5-13-6-12/h9-13H,4-8H2,1-3H3 |
| InChIKey | ADZRWMADPRKEEF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |