C14H27NS — CID 114597778
[1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol (PubChem CID 114597778) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol.
| Compound Name | [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol |
|---|---|
| PubChem CID | 114597778 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol |
| SMILES | CC1CC(C)C(C)N(CC2(CS)CCC2)C1 |
| InChI | InChI=1S/C14H27NS/c1-11-7-12(2)13(3)15(8-11)9-14(10-16)5-4-6-14/h11-13,16H,4-10H2,1-3H3 |
| InChIKey | XLGOPWYMNLTWCD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|