About [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol
[1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol (PubChem CID 114597778) has the molecular formula C14H27NS
and a molecular weight of 241.44 g/mol. Its IUPAC name is [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol.
Molecular Properties
| Compound Name | [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol |
| PubChem CID | 114597778 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol |
| SMILES | CC1CC(C)C(C)N(CC2(CS)CCC2)C1 |
| InChI | InChI=1S/C14H27NS/c1-11-7-12(2)13(3)15(8-11)9-14(10-16)5-4-6-14/h11-13,16H,4-10H2,1-3H3 |
| InChIKey | XLGOPWYMNLTWCD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol?
The IUPAC name of [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol (CID 114597778) is [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol.
What is the SMILES notation for [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol?
The canonical SMILES for [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol is CC1CC(C)C(C)N(CC2(CS)CCC2)C1.
What is the InChIKey of [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol?
The InChIKey is XLGOPWYMNLTWCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NS/c1-11-7-12(2)13(3)15(8-11)9-14(10-16)5-4-6-14/h11-13,16H,4-10H2,1-3H3.
What are the key properties of [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol?
[1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol has a molecular weight of 241.44 g/mol, XLogP of 3.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2,3,5-trimethylpiperidin-1-yl)methyl]cyclobutyl]methanethiol is sourced from PubChem (CID 114597778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).