C12H24N2S — CID 114593354
4-(2,3,5-trimethylpiperidin-1-yl)butanethioamide (PubChem CID 114593354) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is 4-(2,3,5-trimethylpiperidin-1-yl)butanethioamide.
| Compound Name | 4-(2,3,5-trimethylpiperidin-1-yl)butanethioamide |
|---|---|
| PubChem CID | 114593354 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 4-(2,3,5-trimethylpiperidin-1-yl)butanethioamide |
| SMILES | CC1CC(C)C(C)N(CCCC(N)=S)C1 |
| InChI | InChI=1S/C12H24N2S/c1-9-7-10(2)11(3)14(8-9)6-4-5-12(13)15/h9-11H,4-8H2,1-3H3,(H2,13,15) |
| InChIKey | HZAIDLUBVNHYBI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|