C14H30N2 — CID 114593809
2-ethyl-4-(2,3,5-trimethylpiperidin-1-yl)butan-1-amine (PubChem CID 114593809) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 2-ethyl-4-(2,3,5-trimethylpiperidin-1-yl)butan-1-amine.
| Compound Name | 2-ethyl-4-(2,3,5-trimethylpiperidin-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 114593809 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 2-ethyl-4-(2,3,5-trimethylpiperidin-1-yl)butan-1-amine |
| SMILES | CCC(CN)CCN1CC(C)CC(C)C1C |
| InChI | InChI=1S/C14H30N2/c1-5-14(9-15)6-7-16-10-11(2)8-12(3)13(16)4/h11-14H,5-10,15H2,1-4H3 |
| InChIKey | HAWZNOBEYQAKLZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |