C18H26BrNO — CID 114594159
1-(4-bromophenyl)-4-(2,3,5-trimethylpiperidin-1-yl)butan-1-one (PubChem CID 114594159) has the molecular formula C18H26BrNO and a molecular weight of 352.32 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-(2,3,5-trimethylpiperidin-1-yl)butan-1-one.
| Compound Name | 1-(4-bromophenyl)-4-(2,3,5-trimethylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 114594159 |
| Molecular Formula | C18H26BrNO |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-(4-bromophenyl)-4-(2,3,5-trimethylpiperidin-1-yl)butan-1-one |
| SMILES | CC1CC(C)C(C)N(CCCC(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C18H26BrNO/c1-13-11-14(2)15(3)20(12-13)10-4-5-18(21)16-6-8-17(19)9-7-16/h6-9,13-15H,4-5,10-12H2,1-3H3 |
| InChIKey | FKGYWJMGRSRFQO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |