C15H20BrNO — CID 55039891
1-(4-bromophenyl)-2-(2,3-dimethylpiperidin-1-yl)ethanone (PubChem CID 55039891) has the molecular formula C15H20BrNO and a molecular weight of 310.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(2,3-dimethylpiperidin-1-yl)ethanone.
| Compound Name | 1-(4-bromophenyl)-2-(2,3-dimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 55039891 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 1-(4-bromophenyl)-2-(2,3-dimethylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCN(CC(=O)c2ccc(Br)cc2)C1C |
| InChI | InChI=1S/C15H20BrNO/c1-11-4-3-9-17(12(11)2)10-15(18)13-5-7-14(16)8-6-13/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | KCMVIRHSNYJHTB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |