C16H23BrN2O — CID 63610961
1-(4-bromophenyl)-4-(3,4-dimethylpiperazin-1-yl)butan-1-one (PubChem CID 63610961) has the molecular formula C16H23BrN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-(3,4-dimethylpiperazin-1-yl)butan-1-one.
| Compound Name | 1-(4-bromophenyl)-4-(3,4-dimethylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 63610961 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(4-bromophenyl)-4-(3,4-dimethylpiperazin-1-yl)butan-1-one |
| SMILES | CC1CN(CCCC(=O)c2ccc(Br)cc2)CCN1C |
| InChI | InChI=1S/C16H23BrN2O/c1-13-12-19(11-10-18(13)2)9-3-4-16(20)14-5-7-15(17)8-6-14/h5-8,13H,3-4,9-12H2,1-2H3 |
| InChIKey | MXWCACKXUIBLPZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |