C15H32N2 — CID 161246587
2,5-ditert-butyl-2,5-diazabicyclo[2.2.1]heptane;ethane (PubChem CID 161246587) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 2,5-ditert-butyl-2,5-diazabicyclo[2.2.1]heptane;ethane.
| Compound Name | 2,5-ditert-butyl-2,5-diazabicyclo[2.2.1]heptane;ethane |
|---|---|
| PubChem CID | 161246587 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 2,5-ditert-butyl-2,5-diazabicyclo[2.2.1]heptane;ethane |
| SMILES | CC.CC(C)(C)N1CC2CC1CN2C(C)(C)C |
| InChI | InChI=1S/C13H26N2.C2H6/c1-12(2,3)14-8-11-7-10(14)9-15(11)13(4,5)6;1-2/h10-11H,7-9H2,1-6H3;1-2H3 |
| InChIKey | VASHICQISWWMED-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |