C12H22N2O2 — CID 163654402
[3-(5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)oxiran-2-yl]methanol (PubChem CID 163654402) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is [3-(5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)oxiran-2-yl]methanol.
| Compound Name | [3-(5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 163654402 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | [3-(5-tert-butyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)oxiran-2-yl]methanol |
| SMILES | CC(C)(C)N1CC2CC1CN2C1OC1CO |
| InChI | InChI=1S/C12H22N2O2/c1-12(2,3)14-6-8-4-9(14)5-13(8)11-10(7-15)16-11/h8-11,15H,4-7H2,1-3H3 |
| InChIKey | IOXSBANCKIKFIE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 39.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|