C13H27NO — CID 123267586
[(5S)-1,5-ditert-butylpyrrolidin-3-yl]methanol (PubChem CID 123267586) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is [(5S)-1,5-ditert-butylpyrrolidin-3-yl]methanol.
| Compound Name | [(5S)-1,5-ditert-butylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 123267586 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | [(5S)-1,5-ditert-butylpyrrolidin-3-yl]methanol |
| SMILES | CC(C)(C)[C@@H]1CC(CO)CN1C(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-12(2,3)11-7-10(9-15)8-14(11)13(4,5)6/h10-11,15H,7-9H2,1-6H3/t10?,11-/m0/s1 |
| InChIKey | XFKJIPHCTFSDEJ-DTIOYNMSSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |