C25H50FN — CID 159337585
1,2-ditert-butylcyclopentane;1,2-ditert-butyl-4-fluoropyrrolidine (PubChem CID 159337585) has the molecular formula C25H50FN and a molecular weight of 383.68 g/mol. Its IUPAC name is 1,2-ditert-butylcyclopentane;1,2-ditert-butyl-4-fluoropyrrolidine.
| Compound Name | 1,2-ditert-butylcyclopentane;1,2-ditert-butyl-4-fluoropyrrolidine |
|---|---|
| PubChem CID | 159337585 |
| Molecular Formula | C25H50FN |
| Molecular Weight | 383.68 g/mol |
| Exact Mass | 383.39 |
| IUPAC Name | 1,2-ditert-butylcyclopentane;1,2-ditert-butyl-4-fluoropyrrolidine |
| SMILES | CC(C)(C)C1CC(F)CN1C(C)(C)C.CC(C)(C)C1CCCC1C(C)(C)C |
| InChI | InChI=1S/C13H26.C12H24FN/c1-12(2,3)10-8-7-9-11(10)13(4,5)6;1-11(2,3)10-7-9(13)8-14(10)12(4,5)6/h10-11H,7-9H2,1-6H3;9-10H,7-8H2,1-6H3 |
| InChIKey | LFSVPACMTRQRSZ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.68 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |