C10H21N — CID 10920773
1,3-ditert-butyl-2,2-dideuterioaziridine (PubChem CID 10920773) has the molecular formula C10H21N and a molecular weight of 157.30 g/mol. Its IUPAC name is 1,3-ditert-butyl-2,2-dideuterioaziridine.
| Compound Name | 1,3-ditert-butyl-2,2-dideuterioaziridine |
|---|---|
| PubChem CID | 10920773 |
| Molecular Formula | C10H21N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | 1,3-ditert-butyl-2,2-dideuterioaziridine |
| SMILES | [2H]C1([2H])C(C(C)(C)C)N1C(C)(C)C |
| InChI | InChI=1S/C10H21N/c1-9(2,3)8-7-11(8)10(4,5)6/h8H,7H2,1-6H3/i7D2 |
| InChIKey | JYQCZIZCURZHOT-RJSZUWSASA-N |
| XLogP | 2.52 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|