C13H28N2 — CID 90134318
1,4-ditert-butyl-2,2,3,3,5,5,6-heptadeuterio-6-methylpiperazine (PubChem CID 90134318) has the molecular formula C13H28N2 and a molecular weight of 219.42 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,2,3,3,5,5,6-heptadeuterio-6-methylpiperazine.
| Compound Name | 1,4-ditert-butyl-2,2,3,3,5,5,6-heptadeuterio-6-methylpiperazine |
|---|---|
| PubChem CID | 90134318 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 219.42 g/mol |
| Exact Mass | 219.27 |
| IUPAC Name | 1,4-ditert-butyl-2,2,3,3,5,5,6-heptadeuterio-6-methylpiperazine |
| SMILES | [2H]C1([2H])N(C(C)(C)C)C([2H])([2H])C([2H])(C)N(C(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C13H28N2/c1-11-10-14(12(2,3)4)8-9-15(11)13(5,6)7/h11H,8-10H2,1-7H3/i8D2,9D2,10D2,11D |
| InChIKey | ZADJOWHTVVNCNM-UISBTFFKSA-N |
| XLogP | 2.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |