C13H25N — CID 176728519
3-tert-butyl-1,2,2,4,4,5,6,6,7-nonadeuterio-7-propan-2-yl-3-azabicyclo[3.1.1]heptane (PubChem CID 176728519) has the molecular formula C13H25N and a molecular weight of 204.40 g/mol. Its IUPAC name is 3-tert-butyl-1,2,2,4,4,5,6,6,7-nonadeuterio-7-propan-2-yl-3-azabicyclo[3.1.1]heptane.
| Compound Name | 3-tert-butyl-1,2,2,4,4,5,6,6,7-nonadeuterio-7-propan-2-yl-3-azabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 176728519 |
| Molecular Formula | C13H25N |
| Molecular Weight | 204.40 g/mol |
| Exact Mass | 204.26 |
| IUPAC Name | 3-tert-butyl-1,2,2,4,4,5,6,6,7-nonadeuterio-7-propan-2-yl-3-azabicyclo[3.1.1]heptane |
| SMILES | [2H]C1([2H])N(C(C)(C)C)C([2H])([2H])C2([2H])C([2H])([2H])C1([2H])C2([2H])C(C)C |
| InChI | InChI=1S/C13H25N/c1-9(2)12-10-6-11(12)8-14(7-10)13(3,4)5/h9-12H,6-8H2,1-5H3/i6D2,7D2,8D2,10D,11D,12D |
| InChIKey | BBAUJYGNMTVHNZ-YITLABQUSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |