C9H18N2 — CID 176728426
6-tert-butyl-1,2,2,4,4,5,7,7-octadeuterio-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 176728426) has the molecular formula C9H18N2 and a molecular weight of 162.31 g/mol. Its IUPAC name is 6-tert-butyl-1,2,2,4,4,5,7,7-octadeuterio-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 6-tert-butyl-1,2,2,4,4,5,7,7-octadeuterio-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 176728426 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 162.31 g/mol |
| Exact Mass | 162.20 |
| IUPAC Name | 6-tert-butyl-1,2,2,4,4,5,7,7-octadeuterio-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | [2H]C1([2H])NC([2H])([2H])C2([2H])N(C(C)(C)C)C1([2H])C2([2H])[2H] |
| InChI | InChI=1S/C9H18N2/c1-9(2,3)11-7-4-8(11)6-10-5-7/h7-8,10H,4-6H2,1-3H3/i4D2,5D2,6D2,7D,8D |
| InChIKey | JPFHDYRTRAUQEL-GKKZLPEMSA-N |
| XLogP | 0.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |