C13H27N — CID 176728380
1,4-ditert-butyl-2,2,3-trideuteriopiperidine (PubChem CID 176728380) has the molecular formula C13H27N and a molecular weight of 200.38 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,2,3-trideuteriopiperidine.
| Compound Name | 1,4-ditert-butyl-2,2,3-trideuteriopiperidine |
|---|---|
| PubChem CID | 176728380 |
| Molecular Formula | C13H27N |
| Molecular Weight | 200.38 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | 1,4-ditert-butyl-2,2,3-trideuteriopiperidine |
| SMILES | [2H]C1C(C(C)(C)C)CCN(C(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C13H27N/c1-12(2,3)11-7-9-14(10-8-11)13(4,5)6/h11H,7-10H2,1-6H3/i7D,9D2 |
| InChIKey | DAZLXPUSMBNBGA-JGCKBPKKSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |