About 1,3-ditert-butylpiperidine;methane
1,3-ditert-butylpiperidine;methane (PubChem CID 157116364) has the molecular formula C14H31N
and a molecular weight of 213.41 g/mol. Its IUPAC name is 1,3-ditert-butylpiperidine;methane.
Molecular Properties
| Compound Name | 1,3-ditert-butylpiperidine;methane |
| PubChem CID | 157116364 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 1,3-ditert-butylpiperidine;methane |
| SMILES | C.CC(C)(C)C1CCCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H27N.CH4/c1-12(2,3)11-8-7-9-14(10-11)13(4,5)6;/h11H,7-10H2,1-6H3;1H4 |
| InChIKey | AHLIXVBCVOFKOS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-ditert-butylpiperidine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-ditert-butylpiperidine;methane?
The IUPAC name of 1,3-ditert-butylpiperidine;methane (CID 157116364) is 1,3-ditert-butylpiperidine;methane.
What is the SMILES notation for 1,3-ditert-butylpiperidine;methane?
The canonical SMILES for 1,3-ditert-butylpiperidine;methane is C.CC(C)(C)C1CCCN(C(C)(C)C)C1.
What is the InChIKey of 1,3-ditert-butylpiperidine;methane?
The InChIKey is AHLIXVBCVOFKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N.CH4/c1-12(2,3)11-8-7-9-14(10-11)13(4,5)6;/h11H,7-10H2,1-6H3;1H4.
What are the key properties of 1,3-ditert-butylpiperidine;methane?
1,3-ditert-butylpiperidine;methane has a molecular weight of 213.41 g/mol, XLogP of 4.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-ditert-butylpiperidine;methane is sourced from PubChem (CID 157116364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).