C14H31N — CID 157116364
1,3-ditert-butylpiperidine;methane (PubChem CID 157116364) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is 1,3-ditert-butylpiperidine;methane.
| Compound Name | 1,3-ditert-butylpiperidine;methane |
|---|---|
| PubChem CID | 157116364 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 1,3-ditert-butylpiperidine;methane |
| SMILES | C.CC(C)(C)C1CCCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H27N.CH4/c1-12(2,3)11-8-7-9-14(10-11)13(4,5)6;/h11H,7-10H2,1-6H3;1H4 |
| InChIKey | AHLIXVBCVOFKOS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |