C13H27NS — CID 171587771
(5S)-4,5-ditert-butyl-1,4-thiazepane (PubChem CID 171587771) has the molecular formula C13H27NS and a molecular weight of 229.43 g/mol. Its IUPAC name is (5S)-4,5-ditert-butyl-1,4-thiazepane.
| Compound Name | (5S)-4,5-ditert-butyl-1,4-thiazepane |
|---|---|
| PubChem CID | 171587771 |
| Molecular Formula | C13H27NS |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | (5S)-4,5-ditert-butyl-1,4-thiazepane |
| SMILES | CC(C)(C)[C@@H]1CCSCCN1C(C)(C)C |
| InChI | InChI=1S/C13H27NS/c1-12(2,3)11-7-9-15-10-8-14(11)13(4,5)6/h11H,7-10H2,1-6H3/t11-/m0/s1 |
| InChIKey | ASDVJGBCGVUPDT-NSHDSACASA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |