C13H25NO — CID 158896835
1,2-ditert-butylpiperidin-4-one (PubChem CID 158896835) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 1,2-ditert-butylpiperidin-4-one.
| Compound Name | 1,2-ditert-butylpiperidin-4-one |
|---|---|
| PubChem CID | 158896835 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 1,2-ditert-butylpiperidin-4-one |
| SMILES | CC(C)(C)C1CC(=O)CCN1C(C)(C)C |
| InChI | InChI=1S/C13H25NO/c1-12(2,3)11-9-10(15)7-8-14(11)13(4,5)6/h11H,7-9H2,1-6H3 |
| InChIKey | TXJBQMFYSMKHHX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |