C15H22ClNO2S — CID 141361413
(2S,4R)-1-tert-butyl-4-(2-chlorophenyl)sulfonyl-2-methylpyrrolidine (PubChem CID 141361413) has the molecular formula C15H22ClNO2S and a molecular weight of 315.87 g/mol. Its IUPAC name is (2S,4R)-1-tert-butyl-4-(2-chlorophenyl)sulfonyl-2-methylpyrrolidine.
| Compound Name | (2S,4R)-1-tert-butyl-4-(2-chlorophenyl)sulfonyl-2-methylpyrrolidine |
|---|---|
| PubChem CID | 141361413 |
| Molecular Formula | C15H22ClNO2S |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (2S,4R)-1-tert-butyl-4-(2-chlorophenyl)sulfonyl-2-methylpyrrolidine |
| SMILES | C[C@H]1C[C@@H](S(=O)(=O)c2ccccc2Cl)CN1C(C)(C)C |
| InChI | InChI=1S/C15H22ClNO2S/c1-11-9-12(10-17(11)15(2,3)4)20(18,19)14-8-6-5-7-13(14)16/h5-8,11-12H,9-10H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | IJUJNXKUTMNOSH-NWDGAFQWSA-N |
| XLogP | 3.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |