C11H13ClO3S — CID 90107100
trans-(1S,3S)-3-(2-chlorophenyl)sulfonylcyclopentan-1-ol (PubChem CID 90107100) has the molecular formula C11H13ClO3S and a molecular weight of 260.74 g/mol. Its IUPAC name is trans-(1S,3S)-3-(2-chlorophenyl)sulfonylcyclopentan-1-ol.
| Compound Name | trans-(1S,3S)-3-(2-chlorophenyl)sulfonylcyclopentan-1-ol |
|---|---|
| PubChem CID | 90107100 |
| Molecular Formula | C11H13ClO3S |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | trans-(1S,3S)-3-(2-chlorophenyl)sulfonylcyclopentan-1-ol |
| SMILES | O=S(=O)(c1ccccc1Cl)[C@H]1CC[C@H](O)C1 |
| InChI | InChI=1S/C11H13ClO3S/c12-10-3-1-2-4-11(10)16(14,15)9-6-5-8(13)7-9/h1-4,8-9,13H,5-7H2/t8-,9-/m0/s1 |
| InChIKey | IFHIVPPUVUCMKS-IUCAKERBSA-N |
| XLogP | 2.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |