C12H14ClN3O5S — CID 140580366
(2R,4S)-4-(2-chlorophenyl)sulfonyl-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylic acid (PubChem CID 140580366) has the molecular formula C12H14ClN3O5S and a molecular weight of 347.78 g/mol. Its IUPAC name is (2R,4S)-4-(2-chlorophenyl)sulfonyl-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,4S)-4-(2-chlorophenyl)sulfonyl-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 140580366 |
| Molecular Formula | C12H14ClN3O5S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | (2R,4S)-4-(2-chlorophenyl)sulfonyl-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylic acid |
| SMILES | NNC(=O)[C@H]1C[C@H](S(=O)(=O)c2ccccc2Cl)CN1C(=O)O |
| InChI | InChI=1S/C12H14ClN3O5S/c13-8-3-1-2-4-10(8)22(20,21)7-5-9(11(17)15-14)16(6-7)12(18)19/h1-4,7,9H,5-6,14H2,(H,15,17)(H,18,19)/t7-,9+/m0/s1 |
| InChIKey | LFHHGGHCCWPFRE-IONNQARKSA-N |
| XLogP | 0.22 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|