C20H17ClFN3O4S — CID 59543606
(2S,4R)-4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-1-(4-fluorobenzoyl)pyrrolidine-2-carboxamide (PubChem CID 59543606) has the molecular formula C20H17ClFN3O4S and a molecular weight of 449.89 g/mol. Its IUPAC name is (2S,4R)-4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-1-(4-fluorobenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-1-(4-fluorobenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59543606 |
| Molecular Formula | C20H17ClFN3O4S |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | (2S,4R)-4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-1-(4-fluorobenzoyl)pyrrolidine-2-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1C[C@@H](S(=O)(=O)c2ccccc2Cl)CN1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17ClFN3O4S/c21-16-3-1-2-4-18(16)30(28,29)15-11-17(19(26)24-10-9-23)25(12-15)20(27)13-5-7-14(22)8-6-13/h1-8,15,17H,10-12H2,(H,24,26)/t15-,17+/m1/s1 |
| InChIKey | JWCJEIGEQZVGPA-WBVHZDCISA-N |
| XLogP | 2.18 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|