C19H15F3N6O3S — CID 57335772
(2S,4S)-N-(cyanomethyl)-1-(2-cyanopyrimidin-4-yl)-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 57335772) has the molecular formula C19H15F3N6O3S and a molecular weight of 464.43 g/mol. Its IUPAC name is (2S,4S)-N-(cyanomethyl)-1-(2-cyanopyrimidin-4-yl)-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-(cyanomethyl)-1-(2-cyanopyrimidin-4-yl)-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 57335772 |
| Molecular Formula | C19H15F3N6O3S |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | (2S,4S)-N-(cyanomethyl)-1-(2-cyanopyrimidin-4-yl)-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1C[C@H](S(=O)(=O)c2ccccc2C(F)(F)F)CN1c1ccnc(C#N)n1 |
| InChI | InChI=1S/C19H15F3N6O3S/c20-19(21,22)13-3-1-2-4-15(13)32(30,31)12-9-14(18(29)26-8-6-23)28(11-12)17-5-7-25-16(10-24)27-17/h1-5,7,12,14H,8-9,11H2,(H,26,29)/t12-,14-/m0/s1 |
| InChIKey | YVIFONZGYDQFBS-JSGCOSHPSA-N |
| XLogP | 1.43 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|