C16H13F3N4O2S — CID 57335345
4-[(3S)-3-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-1-yl]pyrimidine-2-carbonitrile (PubChem CID 57335345) has the molecular formula C16H13F3N4O2S and a molecular weight of 382.37 g/mol. Its IUPAC name is 4-[(3S)-3-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-1-yl]pyrimidine-2-carbonitrile.
| Compound Name | 4-[(3S)-3-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-1-yl]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 57335345 |
| Molecular Formula | C16H13F3N4O2S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 4-[(3S)-3-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-1-yl]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nccc(N2CC[C@H](S(=O)(=O)c3ccccc3C(F)(F)F)C2)n1 |
| InChI | InChI=1S/C16H13F3N4O2S/c17-16(18,19)12-3-1-2-4-13(12)26(24,25)11-6-8-23(10-11)15-5-7-21-14(9-20)22-15/h1-5,7,11H,6,8,10H2/t11-/m0/s1 |
| InChIKey | RTJNJOLYGSHBKN-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |