C10H10N4 — CID 130587758
4-(3,6-dihydro-2H-pyridin-1-yl)pyrimidine-2-carbonitrile (PubChem CID 130587758) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyridin-1-yl)pyrimidine-2-carbonitrile.
| Compound Name | 4-(3,6-dihydro-2H-pyridin-1-yl)pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 130587758 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyridin-1-yl)pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nccc(N2CC=CCC2)n1 |
| InChI | InChI=1S/C10H10N4/c11-8-9-12-5-4-10(13-9)14-6-2-1-3-7-14/h1-2,4-5H,3,6-7H2 |
| InChIKey | QMAKFWCXERBBOX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|