C13H19N3 — CID 171326518
2-tert-butyl-4-(3,6-dihydro-2H-pyridin-1-yl)pyrimidine (PubChem CID 171326518) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-tert-butyl-4-(3,6-dihydro-2H-pyridin-1-yl)pyrimidine.
| Compound Name | 2-tert-butyl-4-(3,6-dihydro-2H-pyridin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 171326518 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-tert-butyl-4-(3,6-dihydro-2H-pyridin-1-yl)pyrimidine |
| SMILES | CC(C)(C)c1nccc(N2CC=CCC2)n1 |
| InChI | InChI=1S/C13H19N3/c1-13(2,3)12-14-8-7-11(15-12)16-9-5-4-6-10-16/h4-5,7-8H,6,9-10H2,1-3H3 |
| InChIKey | UKKVXVLCFLBTQZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|