C20H30N6 — CID 133333986
2-tert-butyl-4-[4-(2-tert-butylpyrimidin-4-yl)piperazin-1-yl]pyrimidine (PubChem CID 133333986) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is 2-tert-butyl-4-[4-(2-tert-butylpyrimidin-4-yl)piperazin-1-yl]pyrimidine.
| Compound Name | 2-tert-butyl-4-[4-(2-tert-butylpyrimidin-4-yl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133333986 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 2-tert-butyl-4-[4-(2-tert-butylpyrimidin-4-yl)piperazin-1-yl]pyrimidine |
| SMILES | CC(C)(C)c1nccc(N2CCN(c3ccnc(C(C)(C)C)n3)CC2)n1 |
| InChI | InChI=1S/C20H30N6/c1-19(2,3)17-21-9-7-15(23-17)25-11-13-26(14-12-25)16-8-10-22-18(24-16)20(4,5)6/h7-10H,11-14H2,1-6H3 |
| InChIKey | WUBNNXYJAGSHQQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |