C19H31N5O — CID 71862486
[1-(2-tert-butylpyrimidin-4-yl)piperidin-4-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 71862486) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is [1-(2-tert-butylpyrimidin-4-yl)piperidin-4-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [1-(2-tert-butylpyrimidin-4-yl)piperidin-4-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 71862486 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | [1-(2-tert-butylpyrimidin-4-yl)piperidin-4-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)C2CCN(c3ccnc(C(C)(C)C)n3)CC2)CC1 |
| InChI | InChI=1S/C19H31N5O/c1-19(2,3)18-20-8-5-16(21-18)23-9-6-15(7-10-23)17(25)24-13-11-22(4)12-14-24/h5,8,15H,6-7,9-14H2,1-4H3 |
| InChIKey | NQTPYCLIDSCSJK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |